C28H26N4O2S3 — CID 99129089
[2-[4-(6-methyl-1,3-benzothiazol-2-yl)anilino]-2-oxoethyl] (1S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbodithioate (PubChem CID 99129089) has the molecular formula C28H26N4O2S3 and a molecular weight of 546.74 g/mol. Its IUPAC name is [2-[4-(6-methyl-1,3-benzothiazol-2-yl)anilino]-2-oxoethyl] (1S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbodithioate.
| Compound Name | [2-[4-(6-methyl-1,3-benzothiazol-2-yl)anilino]-2-oxoethyl] (1S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbodithioate |
|---|---|
| PubChem CID | 99129089 |
| Molecular Formula | C28H26N4O2S3 |
| Molecular Weight | 546.74 g/mol |
| Exact Mass | 546.12 |
| IUPAC Name | [2-[4-(6-methyl-1,3-benzothiazol-2-yl)anilino]-2-oxoethyl] (1S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbodithioate |
| SMILES | Cc1ccc2nc(-c3ccc(NC(=O)CSC(=S)N4C[C@@H]5C[C@@H](C4)c4cccc(=O)n4C5)cc3)sc2c1 |
| InChI | InChI=1S/C28H26N4O2S3/c1-17-5-10-22-24(11-17)37-27(30-22)19-6-8-21(9-7-19)29-25(33)16-36-28(35)31-13-18-12-20(15-31)23-3-2-4-26(34)32(23)14-18/h2-11,18,20H,12-16H2,1H3,(H,29,33)/t18-,20-/m0/s1 |
| InChIKey | DEXMVCBWWGIUPS-ICSRJNTNSA-N |
| XLogP | 5.51 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.74 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|