C17H19N5O2S3 — CID 23102087
[2-[(5-methyl-1,3,4-thiadiazol-2-yl)amino]-2-oxoethyl] 6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbodithioate (PubChem CID 23102087) has the molecular formula C17H19N5O2S3 and a molecular weight of 421.57 g/mol. Its IUPAC name is [2-[(5-methyl-1,3,4-thiadiazol-2-yl)amino]-2-oxoethyl] 6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbodithioate.
| Compound Name | [2-[(5-methyl-1,3,4-thiadiazol-2-yl)amino]-2-oxoethyl] 6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbodithioate |
|---|---|
| PubChem CID | 23102087 |
| Molecular Formula | C17H19N5O2S3 |
| Molecular Weight | 421.57 g/mol |
| Exact Mass | 421.07 |
| IUPAC Name | [2-[(5-methyl-1,3,4-thiadiazol-2-yl)amino]-2-oxoethyl] 6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbodithioate |
| SMILES | Cc1nnc(NC(=O)CSC(=S)N2CC3CC(C2)c2cccc(=O)n2C3)s1 |
| InChI | InChI=1S/C17H19N5O2S3/c1-10-19-20-16(27-10)18-14(23)9-26-17(25)21-6-11-5-12(8-21)13-3-2-4-15(24)22(13)7-11/h2-4,11-12H,5-9H2,1H3,(H,18,20,23) |
| InChIKey | XVLHDWSWMIOVDE-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.57 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|