C15H17N3O5 — CID 23103282
3-(4-butoxy-3-nitrophenyl)-1-methylpyrazole-5-carboxylic acid (PubChem CID 23103282) has the molecular formula C15H17N3O5 and a molecular weight of 319.32 g/mol. Its IUPAC name is 3-(4-butoxy-3-nitrophenyl)-1-methylpyrazole-5-carboxylic acid.
| Compound Name | 3-(4-butoxy-3-nitrophenyl)-1-methylpyrazole-5-carboxylic acid |
|---|---|
| PubChem CID | 23103282 |
| Molecular Formula | C15H17N3O5 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 3-(4-butoxy-3-nitrophenyl)-1-methylpyrazole-5-carboxylic acid |
| SMILES | CCCCOc1ccc(-c2cc(C(=O)O)n(C)n2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H17N3O5/c1-3-4-7-23-14-6-5-10(8-12(14)18(21)22)11-9-13(15(19)20)17(2)16-11/h5-6,8-9H,3-4,7H2,1-2H3,(H,19,20) |
| InChIKey | BDZFYZTYDWVIEM-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 107.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|