C9H21N3O2 — CID 23103907
1,2-bis(3-methoxypropyl)guanidine (PubChem CID 23103907) has the molecular formula C9H21N3O2 and a molecular weight of 203.29 g/mol. Its IUPAC name is 1,2-bis(3-methoxypropyl)guanidine.
| Compound Name | 1,2-bis(3-methoxypropyl)guanidine |
|---|---|
| PubChem CID | 23103907 |
| Molecular Formula | C9H21N3O2 |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.16 |
| IUPAC Name | 1,2-bis(3-methoxypropyl)guanidine |
| SMILES | COCCC/N=C(\N)NCCCOC |
| InChI | InChI=1S/C9H21N3O2/c1-13-7-3-5-11-9(10)12-6-4-8-14-2/h3-8H2,1-2H3,(H3,10,11,12) |
| InChIKey | JXBZLTNIYNWKMG-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|