C10H22N2OS2 — CID 23104560
N-[2-(dimethylamino)ethyl]-5-sulfanyl-2-(sulfanylmethyl)pentanamide (PubChem CID 23104560) has the molecular formula C10H22N2OS2 and a molecular weight of 250.43 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-5-sulfanyl-2-(sulfanylmethyl)pentanamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-5-sulfanyl-2-(sulfanylmethyl)pentanamide |
|---|---|
| PubChem CID | 23104560 |
| Molecular Formula | C10H22N2OS2 |
| Molecular Weight | 250.43 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-5-sulfanyl-2-(sulfanylmethyl)pentanamide |
| SMILES | CN(C)CCNC(=O)C(CS)CCCS |
| InChI | InChI=1S/C10H22N2OS2/c1-12(2)6-5-11-10(13)9(8-15)4-3-7-14/h9,14-15H,3-8H2,1-2H3,(H,11,13) |
| InChIKey | VKRQDSMMZAEJTD-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.43 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|