C29H29ClN2O4 — CID 23108975
5-chloro-2-[[4-[1-[(3,4-dimethoxyphenyl)methyl]piperidin-4-yl]phenyl]methyl]isoindole-1,3-dione (PubChem CID 23108975) has the molecular formula C29H29ClN2O4 and a molecular weight of 505.01 g/mol. Its IUPAC name is 5-chloro-2-[[4-[1-[(3,4-dimethoxyphenyl)methyl]piperidin-4-yl]phenyl]methyl]isoindole-1,3-dione.
| Compound Name | 5-chloro-2-[[4-[1-[(3,4-dimethoxyphenyl)methyl]piperidin-4-yl]phenyl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 23108975 |
| Molecular Formula | C29H29ClN2O4 |
| Molecular Weight | 505.01 g/mol |
| Exact Mass | 504.18 |
| IUPAC Name | 5-chloro-2-[[4-[1-[(3,4-dimethoxyphenyl)methyl]piperidin-4-yl]phenyl]methyl]isoindole-1,3-dione |
| SMILES | COc1ccc(CN2CCC(c3ccc(CN4C(=O)c5ccc(Cl)cc5C4=O)cc3)CC2)cc1OC |
| InChI | InChI=1S/C29H29ClN2O4/c1-35-26-10-5-20(15-27(26)36-2)17-31-13-11-22(12-14-31)21-6-3-19(4-7-21)18-32-28(33)24-9-8-23(30)16-25(24)29(32)34/h3-10,15-16,22H,11-14,17-18H2,1-2H3 |
| InChIKey | KLVZHMPQGBOYAK-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.01 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|