C20H15BrClNO3 — CID 23111366
N-[5-bromo-2-[(E)-3-phenylprop-2-enoyl]-1-benzofuran-3-yl]-3-chloropropanamide (PubChem CID 23111366) has the molecular formula C20H15BrClNO3 and a molecular weight of 432.70 g/mol. Its IUPAC name is N-[5-bromo-2-[(E)-3-phenylprop-2-enoyl]-1-benzofuran-3-yl]-3-chloropropanamide.
| Compound Name | N-[5-bromo-2-[(E)-3-phenylprop-2-enoyl]-1-benzofuran-3-yl]-3-chloropropanamide |
|---|---|
| PubChem CID | 23111366 |
| Molecular Formula | C20H15BrClNO3 |
| Molecular Weight | 432.70 g/mol |
| Exact Mass | 430.99 |
| IUPAC Name | N-[5-bromo-2-[(E)-3-phenylprop-2-enoyl]-1-benzofuran-3-yl]-3-chloropropanamide |
| SMILES | O=C(CCCl)Nc1c(C(=O)/C=C/c2ccccc2)oc2ccc(Br)cc12 |
| InChI | InChI=1S/C20H15BrClNO3/c21-14-7-9-17-15(12-14)19(23-18(25)10-11-22)20(26-17)16(24)8-6-13-4-2-1-3-5-13/h1-9,12H,10-11H2,(H,23,25)/b8-6+ |
| InChIKey | MNMJGNQUSUSMOH-SOFGYWHQSA-N |
| XLogP | 5.66 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.70 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|