C24H25ClN3O2+ — CID 2311458
dibenzyl-[1-[2-(2-chlorophenyl)hydrazinyl]-2-ethoxy-2-oxoethylidene]azanium (PubChem CID 2311458) has the molecular formula C24H25ClN3O2+ and a molecular weight of 422.94 g/mol. Its IUPAC name is dibenzyl-[1-[2-(2-chlorophenyl)hydrazinyl]-2-ethoxy-2-oxoethylidene]azanium.
| Compound Name | dibenzyl-[1-[2-(2-chlorophenyl)hydrazinyl]-2-ethoxy-2-oxoethylidene]azanium |
|---|---|
| PubChem CID | 2311458 |
| Molecular Formula | C24H25ClN3O2+ |
| Molecular Weight | 422.94 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | dibenzyl-[1-[2-(2-chlorophenyl)hydrazinyl]-2-ethoxy-2-oxoethylidene]azanium |
| SMILES | CCOC(=O)C(NNc1ccccc1Cl)=[N+](Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C24H24ClN3O2/c1-2-30-24(29)23(27-26-22-16-10-9-15-21(22)25)28(17-19-11-5-3-6-12-19)18-20-13-7-4-8-14-20/h3-16H,2,17-18H2,1H3,(H,26,29)/p+1 |
| InChIKey | CLMBJYZRKOEGPO-UHFFFAOYSA-O |
| XLogP | 4.63 |
| TPSA | 53.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.94 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|