C22H33ClN3O2+ — CID 2314479
[1-[2-(2-chlorophenyl)hydrazinyl]-2-ethoxy-2-oxoethylidene]-dicyclohexylazanium (PubChem CID 2314479) has the molecular formula C22H33ClN3O2+ and a molecular weight of 406.98 g/mol. Its IUPAC name is [1-[2-(2-chlorophenyl)hydrazinyl]-2-ethoxy-2-oxoethylidene]-dicyclohexylazanium.
| Compound Name | [1-[2-(2-chlorophenyl)hydrazinyl]-2-ethoxy-2-oxoethylidene]-dicyclohexylazanium |
|---|---|
| PubChem CID | 2314479 |
| Molecular Formula | C22H33ClN3O2+ |
| Molecular Weight | 406.98 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | [1-[2-(2-chlorophenyl)hydrazinyl]-2-ethoxy-2-oxoethylidene]-dicyclohexylazanium |
| SMILES | CCOC(=O)C(NNc1ccccc1Cl)=[N+](C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C22H32ClN3O2/c1-2-28-22(27)21(25-24-20-16-10-9-15-19(20)23)26(17-11-5-3-6-12-17)18-13-7-4-8-14-18/h9-10,15-18H,2-8,11-14H2,1H3,(H,24,27)/p+1 |
| InChIKey | YJQCPHROWXUVCN-UHFFFAOYSA-O |
| XLogP | 4.90 |
| TPSA | 53.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.98 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|