C18H18O6 — CID 23116288
methyl 2-[3,5-dihydroxy-2-(4-hydroxybenzoyl)phenyl]butanoate (PubChem CID 23116288) has the molecular formula C18H18O6 and a molecular weight of 330.34 g/mol. Its IUPAC name is methyl 2-[3,5-dihydroxy-2-(4-hydroxybenzoyl)phenyl]butanoate.
| Compound Name | methyl 2-[3,5-dihydroxy-2-(4-hydroxybenzoyl)phenyl]butanoate |
|---|---|
| PubChem CID | 23116288 |
| Molecular Formula | C18H18O6 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | methyl 2-[3,5-dihydroxy-2-(4-hydroxybenzoyl)phenyl]butanoate |
| SMILES | CCC(C(=O)OC)c1cc(O)cc(O)c1C(=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C18H18O6/c1-3-13(18(23)24-2)14-8-12(20)9-15(21)16(14)17(22)10-4-6-11(19)7-5-10/h4-9,13,19-21H,3H2,1-2H3 |
| InChIKey | UEJXOPFEFBKAEU-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |