About methyl 2-amino-3-methylbutanoate;propyl 4-hydroxybenzoate
methyl 2-amino-3-methylbutanoate;propyl 4-hydroxybenzoate (PubChem CID 177159646) has the molecular formula C16H25NO5
and a molecular weight of 311.38 g/mol. Its IUPAC name is methyl 2-amino-3-methylbutanoate;propyl 4-hydroxybenzoate.
Molecular Properties
| Compound Name | methyl 2-amino-3-methylbutanoate;propyl 4-hydroxybenzoate |
| PubChem CID | 177159646 |
| Molecular Formula | C16H25NO5 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | methyl 2-amino-3-methylbutanoate;propyl 4-hydroxybenzoate |
| SMILES | CCCOC(=O)c1ccc(O)cc1.COC(=O)C(N)C(C)C |
| InChI | InChI=1S/C10H12O3.C6H13NO2/c1-2-7-13-10(12)8-3-5-9(11)6-4-8;1-4(2)5(7)6(8)9-3/h3-6,11H,2,7H2,1H3;4-5H,7H2,1-3H3 |
| InChIKey | QKASABVYEAJLJG-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 98.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 2-amino-3-methylbutanoate;propyl 4-hydroxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-amino-3-methylbutanoate;propyl 4-hydroxybenzoate?
The IUPAC name of methyl 2-amino-3-methylbutanoate;propyl 4-hydroxybenzoate (CID 177159646) is methyl 2-amino-3-methylbutanoate;propyl 4-hydroxybenzoate.
What is the SMILES notation for methyl 2-amino-3-methylbutanoate;propyl 4-hydroxybenzoate?
The canonical SMILES for methyl 2-amino-3-methylbutanoate;propyl 4-hydroxybenzoate is CCCOC(=O)c1ccc(O)cc1.COC(=O)C(N)C(C)C.
What is the InChIKey of methyl 2-amino-3-methylbutanoate;propyl 4-hydroxybenzoate?
The InChIKey is QKASABVYEAJLJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O3.C6H13NO2/c1-2-7-13-10(12)8-3-5-9(11)6-4-8;1-4(2)5(7)6(8)9-3/h3-6,11H,2,7H2,1H3;4-5H,7H2,1-3H3.
What are the key properties of methyl 2-amino-3-methylbutanoate;propyl 4-hydroxybenzoate?
methyl 2-amino-3-methylbutanoate;propyl 4-hydroxybenzoate has a molecular weight of 311.38 g/mol, XLogP of 2.10, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-amino-3-methylbutanoate;propyl 4-hydroxybenzoate is sourced from PubChem (CID 177159646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).