C11H8F9NOS — CID 23123799
2-methyl-4-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfinyl)aniline (PubChem CID 23123799) has the molecular formula C11H8F9NOS and a molecular weight of 373.24 g/mol. Its IUPAC name is 2-methyl-4-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfinyl)aniline.
| Compound Name | 2-methyl-4-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfinyl)aniline |
|---|---|
| PubChem CID | 23123799 |
| Molecular Formula | C11H8F9NOS |
| Molecular Weight | 373.24 g/mol |
| Exact Mass | 373.02 |
| IUPAC Name | 2-methyl-4-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfinyl)aniline |
| SMILES | Cc1cc(S(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)ccc1N |
| InChI | InChI=1S/C11H8F9NOS/c1-5-4-6(2-3-7(5)21)23(22)11(19,20)9(14,15)8(12,13)10(16,17)18/h2-4H,21H2,1H3 |
| InChIKey | XOHATDCBZNYUFP-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.24 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|