C16H11N3O2 — CID 2312767
3-[(3R)-2-oxo-1,3-dihydroindol-3-yl]-1H-quinoxalin-2-one (PubChem CID 2312767) has the molecular formula C16H11N3O2 and a molecular weight of 277.28 g/mol. Its IUPAC name is 3-[(3R)-2-oxo-1,3-dihydroindol-3-yl]-1H-quinoxalin-2-one.
| Compound Name | 3-[(3R)-2-oxo-1,3-dihydroindol-3-yl]-1H-quinoxalin-2-one |
|---|---|
| PubChem CID | 2312767 |
| Molecular Formula | C16H11N3O2 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | 3-[(3R)-2-oxo-1,3-dihydroindol-3-yl]-1H-quinoxalin-2-one |
| SMILES | O=C1Nc2ccccc2[C@@H]1c1nc2ccccc2[nH]c1=O |
| InChI | InChI=1S/C16H11N3O2/c20-15-13(9-5-1-2-6-10(9)18-15)14-16(21)19-12-8-4-3-7-11(12)17-14/h1-8,13H,(H,18,20)(H,19,21)/t13-/m1/s1 |
| InChIKey | KZZBQDOXEGJEEQ-CYBMUJFWSA-N |
| XLogP | 2.01 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |