C23H17N3O2 — CID 172996468
3-(2-oxo-1H-pyridin-3-yl)-4-quinolin-2-yl-3,4-dihydro-1H-quinolin-2-one (PubChem CID 172996468) has the molecular formula C23H17N3O2 and a molecular weight of 367.41 g/mol. Its IUPAC name is 3-(2-oxo-1H-pyridin-3-yl)-4-quinolin-2-yl-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 3-(2-oxo-1H-pyridin-3-yl)-4-quinolin-2-yl-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 172996468 |
| Molecular Formula | C23H17N3O2 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | 3-(2-oxo-1H-pyridin-3-yl)-4-quinolin-2-yl-3,4-dihydro-1H-quinolin-2-one |
| SMILES | O=C1Nc2ccccc2C(c2ccc3ccccc3n2)C1c1ccc[nH]c1=O |
| InChI | InChI=1S/C23H17N3O2/c27-22-16(8-5-13-24-22)21-20(15-7-2-4-10-18(15)26-23(21)28)19-12-11-14-6-1-3-9-17(14)25-19/h1-13,20-21H,(H,24,27)(H,26,28) |
| InChIKey | JASVOUPQEUUGLF-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |