About (E)-2-(4-amino-3-methylphenyl)-4-(4-chlorophenyl)-1,1,1-trifluorobut-3-en-2-ol
(E)-2-(4-amino-3-methylphenyl)-4-(4-chlorophenyl)-1,1,1-trifluorobut-3-en-2-ol (PubChem CID 23131626) has the molecular formula C17H15ClF3NO
and a molecular weight of 341.76 g/mol. Its IUPAC name is (E)-2-(4-amino-3-methylphenyl)-4-(4-chlorophenyl)-1,1,1-trifluorobut-3-en-2-ol.
Molecular Properties
| Compound Name | (E)-2-(4-amino-3-methylphenyl)-4-(4-chlorophenyl)-1,1,1-trifluorobut-3-en-2-ol |
| PubChem CID | 23131626 |
| Molecular Formula | C17H15ClF3NO |
| Molecular Weight | 341.76 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | (E)-2-(4-amino-3-methylphenyl)-4-(4-chlorophenyl)-1,1,1-trifluorobut-3-en-2-ol |
| SMILES | Cc1cc(C(O)(/C=C/c2ccc(Cl)cc2)C(F)(F)F)ccc1N |
| InChI | InChI=1S/C17H15ClF3NO/c1-11-10-13(4-7-15(11)22)16(23,17(19,20)21)9-8-12-2-5-14(18)6-3-12/h2-10,23H,22H2,1H3/b9-8+ |
| InChIKey | ZIHSYHARFAVBMA-CMDGGOBGSA-N |
| XLogP | 4.69 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.76 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (E)-2-(4-amino-3-methylphenyl)-4-(4-chlorophenyl)-1,1,1-trifluorobut-3-en-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2-(4-amino-3-methylphenyl)-4-(4-chlorophenyl)-1,1,1-trifluorobut-3-en-2-ol?
The IUPAC name of (E)-2-(4-amino-3-methylphenyl)-4-(4-chlorophenyl)-1,1,1-trifluorobut-3-en-2-ol (CID 23131626) is (E)-2-(4-amino-3-methylphenyl)-4-(4-chlorophenyl)-1,1,1-trifluorobut-3-en-2-ol.
What is the SMILES notation for (E)-2-(4-amino-3-methylphenyl)-4-(4-chlorophenyl)-1,1,1-trifluorobut-3-en-2-ol?
The canonical SMILES for (E)-2-(4-amino-3-methylphenyl)-4-(4-chlorophenyl)-1,1,1-trifluorobut-3-en-2-ol is Cc1cc(C(O)(/C=C/c2ccc(Cl)cc2)C(F)(F)F)ccc1N.
What is the InChIKey of (E)-2-(4-amino-3-methylphenyl)-4-(4-chlorophenyl)-1,1,1-trifluorobut-3-en-2-ol?
The InChIKey is ZIHSYHARFAVBMA-CMDGGOBGSA-N. The full InChI is InChI=1S/C17H15ClF3NO/c1-11-10-13(4-7-15(11)22)16(23,17(19,20)21)9-8-12-2-5-14(18)6-3-12/h2-10,23H,22H2,1H3/b9-8+.
What are the key properties of (E)-2-(4-amino-3-methylphenyl)-4-(4-chlorophenyl)-1,1,1-trifluorobut-3-en-2-ol?
(E)-2-(4-amino-3-methylphenyl)-4-(4-chlorophenyl)-1,1,1-trifluorobut-3-en-2-ol has a molecular weight of 341.76 g/mol, XLogP of 4.69, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2-(4-amino-3-methylphenyl)-4-(4-chlorophenyl)-1,1,1-trifluorobut-3-en-2-ol is sourced from PubChem (CID 23131626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).