C15H18N6O4S — CID 23133627
6-[4-[(4-methyl-2,5-dioxoimidazolidin-4-yl)methylsulfonyl]piperazin-1-yl]pyridine-3-carbonitrile (PubChem CID 23133627) has the molecular formula C15H18N6O4S and a molecular weight of 378.41 g/mol. Its IUPAC name is 6-[4-[(4-methyl-2,5-dioxoimidazolidin-4-yl)methylsulfonyl]piperazin-1-yl]pyridine-3-carbonitrile.
| Compound Name | 6-[4-[(4-methyl-2,5-dioxoimidazolidin-4-yl)methylsulfonyl]piperazin-1-yl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 23133627 |
| Molecular Formula | C15H18N6O4S |
| Molecular Weight | 378.41 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | 6-[4-[(4-methyl-2,5-dioxoimidazolidin-4-yl)methylsulfonyl]piperazin-1-yl]pyridine-3-carbonitrile |
| SMILES | CC1(CS(=O)(=O)N2CCN(c3ccc(C#N)cn3)CC2)NC(=O)NC1=O |
| InChI | InChI=1S/C15H18N6O4S/c1-15(13(22)18-14(23)19-15)10-26(24,25)21-6-4-20(5-7-21)12-3-2-11(8-16)9-17-12/h2-3,9H,4-7,10H2,1H3,(H2,18,19,22,23) |
| InChIKey | RFIXIWTVLRFVNF-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 135.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.41 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|