About 1-[[(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]methylsulfonyl]piperidine-4-carboxylic acid
1-[[(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]methylsulfonyl]piperidine-4-carboxylic acid (PubChem CID 69288109) has the molecular formula C11H17N3O6S
and a molecular weight of 319.34 g/mol. Its IUPAC name is 1-[[(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]methylsulfonyl]piperidine-4-carboxylic acid.
Molecular Properties
| Compound Name | 1-[[(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]methylsulfonyl]piperidine-4-carboxylic acid |
| PubChem CID | 69288109 |
| Molecular Formula | C11H17N3O6S |
| Molecular Weight | 319.34 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | 1-[[(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]methylsulfonyl]piperidine-4-carboxylic acid |
| SMILES | C[C@]1(CS(=O)(=O)N2CCC(C(=O)O)CC2)NC(=O)NC1=O |
| InChI | InChI=1S/C11H17N3O6S/c1-11(9(17)12-10(18)13-11)6-21(19,20)14-4-2-7(3-5-14)8(15)16/h7H,2-6H2,1H3,(H,15,16)(H2,12,13,17,18)/t11-/m1/s1 |
| InChIKey | IEKWBBCMXGHSMT-LLVKDONJSA-N |
| XLogP | -1.29 |
| TPSA | 132.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.34 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze 1-[[(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]methylsulfonyl]piperidine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]methylsulfonyl]piperidine-4-carboxylic acid?
The IUPAC name of 1-[[(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]methylsulfonyl]piperidine-4-carboxylic acid (CID 69288109) is 1-[[(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]methylsulfonyl]piperidine-4-carboxylic acid.
What is the SMILES notation for 1-[[(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]methylsulfonyl]piperidine-4-carboxylic acid?
The canonical SMILES for 1-[[(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]methylsulfonyl]piperidine-4-carboxylic acid is C[C@]1(CS(=O)(=O)N2CCC(C(=O)O)CC2)NC(=O)NC1=O.
What is the InChIKey of 1-[[(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]methylsulfonyl]piperidine-4-carboxylic acid?
The InChIKey is IEKWBBCMXGHSMT-LLVKDONJSA-N. The full InChI is InChI=1S/C11H17N3O6S/c1-11(9(17)12-10(18)13-11)6-21(19,20)14-4-2-7(3-5-14)8(15)16/h7H,2-6H2,1H3,(H,15,16)(H2,12,13,17,18)/t11-/m1/s1.
What are the key properties of 1-[[(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]methylsulfonyl]piperidine-4-carboxylic acid?
1-[[(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]methylsulfonyl]piperidine-4-carboxylic acid has a molecular weight of 319.34 g/mol, XLogP of -1.29, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]methylsulfonyl]piperidine-4-carboxylic acid is sourced from PubChem (CID 69288109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).