C11H17N3O6S — CID 69288109
1-[[(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]methylsulfonyl]piperidine-4-carboxylic acid (PubChem CID 69288109) has the molecular formula C11H17N3O6S and a molecular weight of 319.34 g/mol. Its IUPAC name is 1-[[(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]methylsulfonyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[[(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]methylsulfonyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 69288109 |
| Molecular Formula | C11H17N3O6S |
| Molecular Weight | 319.34 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | 1-[[(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]methylsulfonyl]piperidine-4-carboxylic acid |
| SMILES | C[C@]1(CS(=O)(=O)N2CCC(C(=O)O)CC2)NC(=O)NC1=O |
| InChI | InChI=1S/C11H17N3O6S/c1-11(9(17)12-10(18)13-11)6-21(19,20)14-4-2-7(3-5-14)8(15)16/h7H,2-6H2,1H3,(H,15,16)(H2,12,13,17,18)/t11-/m1/s1 |
| InChIKey | IEKWBBCMXGHSMT-LLVKDONJSA-N |
| XLogP | -1.29 |
| TPSA | 132.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.34 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|