C6H10N2O4S — CID 59710540
(5R)-5-methyl-5-(methylsulfonylmethyl)imidazolidine-2,4-dione (PubChem CID 59710540) has the molecular formula C6H10N2O4S and a molecular weight of 206.22 g/mol. Its IUPAC name is (5R)-5-methyl-5-(methylsulfonylmethyl)imidazolidine-2,4-dione.
| Compound Name | (5R)-5-methyl-5-(methylsulfonylmethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 59710540 |
| Molecular Formula | C6H10N2O4S |
| Molecular Weight | 206.22 g/mol |
| Exact Mass | 206.04 |
| IUPAC Name | (5R)-5-methyl-5-(methylsulfonylmethyl)imidazolidine-2,4-dione |
| SMILES | C[C@@]1(CS(C)(=O)=O)NC(=O)NC1=O |
| InChI | InChI=1S/C6H10N2O4S/c1-6(3-13(2,11)12)4(9)7-5(10)8-6/h3H2,1-2H3,(H2,7,8,9,10)/t6-/m0/s1 |
| InChIKey | VWADZWWWCFECPV-LURJTMIESA-N |
| XLogP | -1.37 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.22 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|