C5H7ClN2O4S — CID 55279232
[(4R)-4-methyl-2,5-dioxoimidazolidin-4-yl]methanesulfonyl chloride (PubChem CID 55279232) has the molecular formula C5H7ClN2O4S and a molecular weight of 226.64 g/mol. Its IUPAC name is [(4R)-4-methyl-2,5-dioxoimidazolidin-4-yl]methanesulfonyl chloride.
| Compound Name | [(4R)-4-methyl-2,5-dioxoimidazolidin-4-yl]methanesulfonyl chloride |
|---|---|
| PubChem CID | 55279232 |
| Molecular Formula | C5H7ClN2O4S |
| Molecular Weight | 226.64 g/mol |
| Exact Mass | 225.98 |
| IUPAC Name | [(4R)-4-methyl-2,5-dioxoimidazolidin-4-yl]methanesulfonyl chloride |
| SMILES | C[C@@]1(CS(=O)(=O)Cl)NC(=O)NC1=O |
| InChI | InChI=1S/C5H7ClN2O4S/c1-5(2-13(6,11)12)3(9)7-4(10)8-5/h2H2,1H3,(H2,7,8,9,10)/t5-/m0/s1 |
| InChIKey | GXBXYLVXNQXXNV-YFKPBYRVSA-N |
| XLogP | -0.85 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.64 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|