C17H20F3N3O6S — CID 59794410
(5S)-5-methyl-5-[[4-[3-(trifluoromethoxy)phenoxy]piperidin-1-yl]sulfonylmethyl]imidazolidine-2,4-dione (PubChem CID 59794410) has the molecular formula C17H20F3N3O6S and a molecular weight of 451.42 g/mol. Its IUPAC name is (5S)-5-methyl-5-[[4-[3-(trifluoromethoxy)phenoxy]piperidin-1-yl]sulfonylmethyl]imidazolidine-2,4-dione.
| Compound Name | (5S)-5-methyl-5-[[4-[3-(trifluoromethoxy)phenoxy]piperidin-1-yl]sulfonylmethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 59794410 |
| Molecular Formula | C17H20F3N3O6S |
| Molecular Weight | 451.42 g/mol |
| Exact Mass | 451.10 |
| IUPAC Name | (5S)-5-methyl-5-[[4-[3-(trifluoromethoxy)phenoxy]piperidin-1-yl]sulfonylmethyl]imidazolidine-2,4-dione |
| SMILES | C[C@]1(CS(=O)(=O)N2CCC(Oc3cccc(OC(F)(F)F)c3)CC2)NC(=O)NC1=O |
| InChI | InChI=1S/C17H20F3N3O6S/c1-16(14(24)21-15(25)22-16)10-30(26,27)23-7-5-11(6-8-23)28-12-3-2-4-13(9-12)29-17(18,19)20/h2-4,9,11H,5-8,10H2,1H3,(H2,21,22,24,25)/t16-/m1/s1 |
| InChIKey | JLHIOOQPYFJSCF-MRXNPFEDSA-N |
| XLogP | 1.36 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.42 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|