C17H20N4O5S — CID 69288611
4-[1-[(4-methyl-2,5-dioxoimidazolidin-4-yl)methylsulfonyl]piperidin-4-yl]oxybenzonitrile (PubChem CID 69288611) has the molecular formula C17H20N4O5S and a molecular weight of 392.44 g/mol. Its IUPAC name is 4-[1-[(4-methyl-2,5-dioxoimidazolidin-4-yl)methylsulfonyl]piperidin-4-yl]oxybenzonitrile.
| Compound Name | 4-[1-[(4-methyl-2,5-dioxoimidazolidin-4-yl)methylsulfonyl]piperidin-4-yl]oxybenzonitrile |
|---|---|
| PubChem CID | 69288611 |
| Molecular Formula | C17H20N4O5S |
| Molecular Weight | 392.44 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | 4-[1-[(4-methyl-2,5-dioxoimidazolidin-4-yl)methylsulfonyl]piperidin-4-yl]oxybenzonitrile |
| SMILES | CC1(CS(=O)(=O)N2CCC(Oc3ccc(C#N)cc3)CC2)NC(=O)NC1=O |
| InChI | InChI=1S/C17H20N4O5S/c1-17(15(22)19-16(23)20-17)11-27(24,25)21-8-6-14(7-9-21)26-13-4-2-12(10-18)3-5-13/h2-5,14H,6-9,11H2,1H3,(H2,19,20,22,23) |
| InChIKey | QGMCYSYDIYFILU-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 128.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.44 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|