C5H9N3O4S — CID 141057979
[(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]methanesulfonamide (PubChem CID 141057979) has the molecular formula C5H9N3O4S and a molecular weight of 207.21 g/mol. Its IUPAC name is [(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]methanesulfonamide.
| Compound Name | [(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]methanesulfonamide |
|---|---|
| PubChem CID | 141057979 |
| Molecular Formula | C5H9N3O4S |
| Molecular Weight | 207.21 g/mol |
| Exact Mass | 207.03 |
| IUPAC Name | [(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]methanesulfonamide |
| SMILES | C[C@]1(CS(N)(=O)=O)NC(=O)NC1=O |
| InChI | InChI=1S/C5H9N3O4S/c1-5(2-13(6,11)12)3(9)7-4(10)8-5/h2H2,1H3,(H2,6,11,12)(H2,7,8,9,10)/t5-/m1/s1 |
| InChIKey | BXNKDFDRWOHDJT-RXMQYKEDSA-N |
| XLogP | -2.13 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.21 |
| LogP ≤ 5 | -2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|