C9H15N3O2 — CID 99978564
(5R)-5-methyl-5-[[(2R)-pyrrolidin-2-yl]methyl]imidazolidine-2,4-dione (PubChem CID 99978564) has the molecular formula C9H15N3O2 and a molecular weight of 197.24 g/mol. Its IUPAC name is (5R)-5-methyl-5-[[(2R)-pyrrolidin-2-yl]methyl]imidazolidine-2,4-dione.
| Compound Name | (5R)-5-methyl-5-[[(2R)-pyrrolidin-2-yl]methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 99978564 |
| Molecular Formula | C9H15N3O2 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | (5R)-5-methyl-5-[[(2R)-pyrrolidin-2-yl]methyl]imidazolidine-2,4-dione |
| SMILES | C[C@]1(C[C@H]2CCCN2)NC(=O)NC1=O |
| InChI | InChI=1S/C9H15N3O2/c1-9(5-6-3-2-4-10-6)7(13)11-8(14)12-9/h6,10H,2-5H2,1H3,(H2,11,12,13,14)/t6-,9-/m1/s1 |
| InChIKey | KLQZPAVZGUJVAF-HZGVNTEJSA-N |
| XLogP | -0.27 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|