C15H23N3O4SSi — CID 67351634
(5S)-5-methyl-5-[[4-(2-trimethylsilylethynyl)-3,6-dihydro-2H-pyridin-1-yl]sulfonylmethyl]imidazolidine-2,4-dione (PubChem CID 67351634) has the molecular formula C15H23N3O4SSi and a molecular weight of 369.52 g/mol. Its IUPAC name is (5S)-5-methyl-5-[[4-(2-trimethylsilylethynyl)-3,6-dihydro-2H-pyridin-1-yl]sulfonylmethyl]imidazolidine-2,4-dione.
| Compound Name | (5S)-5-methyl-5-[[4-(2-trimethylsilylethynyl)-3,6-dihydro-2H-pyridin-1-yl]sulfonylmethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 67351634 |
| Molecular Formula | C15H23N3O4SSi |
| Molecular Weight | 369.52 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | (5S)-5-methyl-5-[[4-(2-trimethylsilylethynyl)-3,6-dihydro-2H-pyridin-1-yl]sulfonylmethyl]imidazolidine-2,4-dione |
| SMILES | C[C@]1(CS(=O)(=O)N2CC=C(C#C[Si](C)(C)C)CC2)NC(=O)NC1=O |
| InChI | InChI=1S/C15H23N3O4SSi/c1-15(13(19)16-14(20)17-15)11-23(21,22)18-8-5-12(6-9-18)7-10-24(2,3)4/h5H,6,8-9,11H2,1-4H3,(H2,16,17,19,20)/t15-/m1/s1 |
| InChIKey | NLCCUVUGZREQIO-OAHLLOKOSA-N |
| XLogP | 0.43 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.52 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|