C17H18N4O4S — CID 59794396
(5S)-5-methyl-5-[[4-(2-pyridin-2-ylethynyl)-3,6-dihydro-2H-pyridin-1-yl]sulfonylmethyl]imidazolidine-2,4-dione (PubChem CID 59794396) has the molecular formula C17H18N4O4S and a molecular weight of 374.42 g/mol. Its IUPAC name is (5S)-5-methyl-5-[[4-(2-pyridin-2-ylethynyl)-3,6-dihydro-2H-pyridin-1-yl]sulfonylmethyl]imidazolidine-2,4-dione.
| Compound Name | (5S)-5-methyl-5-[[4-(2-pyridin-2-ylethynyl)-3,6-dihydro-2H-pyridin-1-yl]sulfonylmethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 59794396 |
| Molecular Formula | C17H18N4O4S |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | (5S)-5-methyl-5-[[4-(2-pyridin-2-ylethynyl)-3,6-dihydro-2H-pyridin-1-yl]sulfonylmethyl]imidazolidine-2,4-dione |
| SMILES | C[C@]1(CS(=O)(=O)N2CC=C(C#Cc3ccccn3)CC2)NC(=O)NC1=O |
| InChI | InChI=1S/C17H18N4O4S/c1-17(15(22)19-16(23)20-17)12-26(24,25)21-10-7-13(8-11-21)5-6-14-4-2-3-9-18-14/h2-4,7,9H,8,10-12H2,1H3,(H2,19,20,22,23)/t17-/m1/s1 |
| InChIKey | UJOBERMWOZAGMZ-QGZVFWFLSA-N |
| XLogP | -0.01 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|