C5H18N2O12P4 — CID 23134828
[[1-aminopropan-2-yl(diphosphonomethyl)amino]-phosphonomethyl]phosphonic acid (PubChem CID 23134828) has the molecular formula C5H18N2O12P4 and a molecular weight of 422.10 g/mol. Its IUPAC name is [[1-aminopropan-2-yl(diphosphonomethyl)amino]-phosphonomethyl]phosphonic acid.
| Compound Name | [[1-aminopropan-2-yl(diphosphonomethyl)amino]-phosphonomethyl]phosphonic acid |
|---|---|
| PubChem CID | 23134828 |
| Molecular Formula | C5H18N2O12P4 |
| Molecular Weight | 422.10 g/mol |
| Exact Mass | 421.98 |
| IUPAC Name | [[1-aminopropan-2-yl(diphosphonomethyl)amino]-phosphonomethyl]phosphonic acid |
| SMILES | CC(CN)N(C(P(=O)(O)O)P(=O)(O)O)C(P(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C5H18N2O12P4/c1-3(2-6)7(4(20(8,9)10)21(11,12)13)5(22(14,15)16)23(17,18)19/h3-5H,2,6H2,1H3,(H2,8,9,10)(H2,11,12,13)(H2,14,15,16)(H2,17,18,19) |
| InChIKey | AGEDRVKHXUWACM-UHFFFAOYSA-N |
| XLogP | -2.09 |
| TPSA | 259.38 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.10 |
| LogP ≤ 5 | -2.09 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|