C16H31P — CID 23135836
di(propan-2-yl)-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)phosphane (PubChem CID 23135836) has the molecular formula C16H31P and a molecular weight of 254.40 g/mol. Its IUPAC name is di(propan-2-yl)-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)phosphane.
| Compound Name | di(propan-2-yl)-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)phosphane |
|---|---|
| PubChem CID | 23135836 |
| Molecular Formula | C16H31P |
| Molecular Weight | 254.40 g/mol |
| Exact Mass | 254.22 |
| IUPAC Name | di(propan-2-yl)-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)phosphane |
| SMILES | CC(C)P(C(C)C)C1CC2CCC1(C)C2(C)C |
| InChI | InChI=1S/C16H31P/c1-11(2)17(12(3)4)14-10-13-8-9-16(14,7)15(13,5)6/h11-14H,8-10H2,1-7H3 |
| InChIKey | KTRKEDAAMQSGJO-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.40 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|