C41H50N2O4 — CID 23140869
N,N'-bis(1-hydroxy-4-methyl-1,1-diphenylpentan-2-yl)-2,2-dimethylpropanediamide (PubChem CID 23140869) has the molecular formula C41H50N2O4 and a molecular weight of 634.86 g/mol. Its IUPAC name is N,N'-bis(1-hydroxy-4-methyl-1,1-diphenylpentan-2-yl)-2,2-dimethylpropanediamide.
| Compound Name | N,N'-bis(1-hydroxy-4-methyl-1,1-diphenylpentan-2-yl)-2,2-dimethylpropanediamide |
|---|---|
| PubChem CID | 23140869 |
| Molecular Formula | C41H50N2O4 |
| Molecular Weight | 634.86 g/mol |
| Exact Mass | 634.38 |
| IUPAC Name | N,N'-bis(1-hydroxy-4-methyl-1,1-diphenylpentan-2-yl)-2,2-dimethylpropanediamide |
| SMILES | CC(C)CC(NC(=O)C(C)(C)C(=O)NC(CC(C)C)C(O)(c1ccccc1)c1ccccc1)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C41H50N2O4/c1-29(2)27-35(40(46,31-19-11-7-12-20-31)32-21-13-8-14-22-32)42-37(44)39(5,6)38(45)43-36(28-30(3)4)41(47,33-23-15-9-16-24-33)34-25-17-10-18-26-34/h7-26,29-30,35-36,46-47H,27-28H2,1-6H3,(H,42,44)(H,43,45) |
| InChIKey | NNXYDNIODPKKOW-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.86 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|