C42H36N2O4 — CID 23140890
N,N'-bis(2-hydroxy-1,2,2-triphenylethyl)oxamide (PubChem CID 23140890) has the molecular formula C42H36N2O4 and a molecular weight of 632.76 g/mol. Its IUPAC name is N,N'-bis(2-hydroxy-1,2,2-triphenylethyl)oxamide.
| Compound Name | N,N'-bis(2-hydroxy-1,2,2-triphenylethyl)oxamide |
|---|---|
| PubChem CID | 23140890 |
| Molecular Formula | C42H36N2O4 |
| Molecular Weight | 632.76 g/mol |
| Exact Mass | 632.27 |
| IUPAC Name | N,N'-bis(2-hydroxy-1,2,2-triphenylethyl)oxamide |
| SMILES | O=C(NC(c1ccccc1)C(O)(c1ccccc1)c1ccccc1)C(=O)NC(c1ccccc1)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C42H36N2O4/c45-39(43-37(31-19-7-1-8-20-31)41(47,33-23-11-3-12-24-33)34-25-13-4-14-26-34)40(46)44-38(32-21-9-2-10-22-32)42(48,35-27-15-5-16-28-35)36-29-17-6-18-30-36/h1-30,37-38,47-48H,(H,43,45)(H,44,46) |
| InChIKey | IDGFCQPWXXSBJP-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.76 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|