C14H24N2O4 — CID 23140938
N,N'-bis[1-(1-hydroxycyclobutyl)ethyl]oxamide (PubChem CID 23140938) has the molecular formula C14H24N2O4 and a molecular weight of 284.36 g/mol. Its IUPAC name is N,N'-bis[1-(1-hydroxycyclobutyl)ethyl]oxamide.
| Compound Name | N,N'-bis[1-(1-hydroxycyclobutyl)ethyl]oxamide |
|---|---|
| PubChem CID | 23140938 |
| Molecular Formula | C14H24N2O4 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | N,N'-bis[1-(1-hydroxycyclobutyl)ethyl]oxamide |
| SMILES | CC(NC(=O)C(=O)NC(C)C1(O)CCC1)C1(O)CCC1 |
| InChI | InChI=1S/C14H24N2O4/c1-9(13(19)5-3-6-13)15-11(17)12(18)16-10(2)14(20)7-4-8-14/h9-10,19-20H,3-8H2,1-2H3,(H,15,17)(H,16,18) |
| InChIKey | SMQAOLHTQDMSKI-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|