C21H22F3NO5 — CID 23141398
N-(2,4-dihydroxybutyl)-4-methoxy-3-[(E)-2-[4-(trifluoromethoxy)phenyl]ethenyl]benzamide (PubChem CID 23141398) has the molecular formula C21H22F3NO5 and a molecular weight of 425.40 g/mol. Its IUPAC name is N-(2,4-dihydroxybutyl)-4-methoxy-3-[(E)-2-[4-(trifluoromethoxy)phenyl]ethenyl]benzamide.
| Compound Name | N-(2,4-dihydroxybutyl)-4-methoxy-3-[(E)-2-[4-(trifluoromethoxy)phenyl]ethenyl]benzamide |
|---|---|
| PubChem CID | 23141398 |
| Molecular Formula | C21H22F3NO5 |
| Molecular Weight | 425.40 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | N-(2,4-dihydroxybutyl)-4-methoxy-3-[(E)-2-[4-(trifluoromethoxy)phenyl]ethenyl]benzamide |
| SMILES | COc1ccc(C(=O)NCC(O)CCO)cc1/C=C/c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C21H22F3NO5/c1-29-19-9-6-16(20(28)25-13-17(27)10-11-26)12-15(19)5-2-14-3-7-18(8-4-14)30-21(22,23)24/h2-9,12,17,26-27H,10-11,13H2,1H3,(H,25,28)/b5-2+ |
| InChIKey | PTPSFXHIKIYJIF-GORDUTHDSA-N |
| XLogP | 3.24 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.40 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|