C31H45N3O2 — CID 23142971
1-(furan-3-ylmethyl)-4-[4-(4-methoxypiperidin-1-yl)-2-(3,3,5,5-tetramethylcyclohexen-1-yl)phenyl]piperazine (PubChem CID 23142971) has the molecular formula C31H45N3O2 and a molecular weight of 491.72 g/mol. Its IUPAC name is 1-(furan-3-ylmethyl)-4-[4-(4-methoxypiperidin-1-yl)-2-(3,3,5,5-tetramethylcyclohexen-1-yl)phenyl]piperazine.
| Compound Name | 1-(furan-3-ylmethyl)-4-[4-(4-methoxypiperidin-1-yl)-2-(3,3,5,5-tetramethylcyclohexen-1-yl)phenyl]piperazine |
|---|---|
| PubChem CID | 23142971 |
| Molecular Formula | C31H45N3O2 |
| Molecular Weight | 491.72 g/mol |
| Exact Mass | 491.35 |
| IUPAC Name | 1-(furan-3-ylmethyl)-4-[4-(4-methoxypiperidin-1-yl)-2-(3,3,5,5-tetramethylcyclohexen-1-yl)phenyl]piperazine |
| SMILES | COC1CCN(c2ccc(N3CCN(Cc4ccoc4)CC3)c(C3=CC(C)(C)CC(C)(C)C3)c2)CC1 |
| InChI | InChI=1S/C31H45N3O2/c1-30(2)19-25(20-31(3,4)23-30)28-18-26(33-11-8-27(35-5)9-12-33)6-7-29(28)34-15-13-32(14-16-34)21-24-10-17-36-22-24/h6-7,10,17-19,22,27H,8-9,11-16,20-21,23H2,1-5H3 |
| InChIKey | NVVLCHZNLCHHBH-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 32.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.72 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|