C15H25FNO2+ — CID 2314449
butyl-[(2S)-3-[(2-fluorophenyl)methoxy]-2-hydroxypropyl]-methylazanium (PubChem CID 2314449) has the molecular formula C15H25FNO2+ and a molecular weight of 270.37 g/mol. Its IUPAC name is butyl-[(2S)-3-[(2-fluorophenyl)methoxy]-2-hydroxypropyl]-methylazanium.
| Compound Name | butyl-[(2S)-3-[(2-fluorophenyl)methoxy]-2-hydroxypropyl]-methylazanium |
|---|---|
| PubChem CID | 2314449 |
| Molecular Formula | C15H25FNO2+ |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.19 |
| IUPAC Name | butyl-[(2S)-3-[(2-fluorophenyl)methoxy]-2-hydroxypropyl]-methylazanium |
| SMILES | CCCC[NH+](C)C[C@H](O)COCc1ccccc1F |
| InChI | InChI=1S/C15H24FNO2/c1-3-4-9-17(2)10-14(18)12-19-11-13-7-5-6-8-15(13)16/h5-8,14,18H,3-4,9-12H2,1-2H3/p+1/t14-/m0/s1 |
| InChIKey | WLLPWOTUJWPARI-AWEZNQCLSA-O |
| XLogP | 1.02 |
| TPSA | 33.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |