C18H30FNO2 — CID 2314442
(2R)-1-(dibutylamino)-3-[(2-fluorophenyl)methoxy]propan-2-ol (PubChem CID 2314442) has the molecular formula C18H30FNO2 and a molecular weight of 311.44 g/mol. Its IUPAC name is (2R)-1-(dibutylamino)-3-[(2-fluorophenyl)methoxy]propan-2-ol.
| Compound Name | (2R)-1-(dibutylamino)-3-[(2-fluorophenyl)methoxy]propan-2-ol |
|---|---|
| PubChem CID | 2314442 |
| Molecular Formula | C18H30FNO2 |
| Molecular Weight | 311.44 g/mol |
| Exact Mass | 311.23 |
| IUPAC Name | (2R)-1-(dibutylamino)-3-[(2-fluorophenyl)methoxy]propan-2-ol |
| SMILES | CCCCN(CCCC)C[C@@H](O)COCc1ccccc1F |
| InChI | InChI=1S/C18H30FNO2/c1-3-5-11-20(12-6-4-2)13-17(21)15-22-14-16-9-7-8-10-18(16)19/h7-10,17,21H,3-6,11-15H2,1-2H3/t17-/m1/s1 |
| InChIKey | AFAUZGYXRCPVAX-QGZVFWFLSA-N |
| XLogP | 3.61 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.44 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |