C42H39F2N3O4 — CID 23148300
tert-butyl N-[3-[1-[(3,4-difluorophenyl)methyl]indol-3-yl]-1-oxo-1-(trityloxyamino)propan-2-yl]carbamate (PubChem CID 23148300) has the molecular formula C42H39F2N3O4 and a molecular weight of 687.79 g/mol. Its IUPAC name is tert-butyl N-[3-[1-[(3,4-difluorophenyl)methyl]indol-3-yl]-1-oxo-1-(trityloxyamino)propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[3-[1-[(3,4-difluorophenyl)methyl]indol-3-yl]-1-oxo-1-(trityloxyamino)propan-2-yl]carbamate |
|---|---|
| PubChem CID | 23148300 |
| Molecular Formula | C42H39F2N3O4 |
| Molecular Weight | 687.79 g/mol |
| Exact Mass | 687.29 |
| IUPAC Name | tert-butyl N-[3-[1-[(3,4-difluorophenyl)methyl]indol-3-yl]-1-oxo-1-(trityloxyamino)propan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(Cc1cn(Cc2ccc(F)c(F)c2)c2ccccc12)C(=O)NOC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C42H39F2N3O4/c1-41(2,3)50-40(49)45-37(26-30-28-47(38-22-14-13-21-34(30)38)27-29-23-24-35(43)36(44)25-29)39(48)46-51-42(31-15-7-4-8-16-31,32-17-9-5-10-18-32)33-19-11-6-12-20-33/h4-25,28,37H,26-27H2,1-3H3,(H,45,49)(H,46,48) |
| InChIKey | GHWYEQGZBGBPHQ-UHFFFAOYSA-N |
| XLogP | 8.44 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.79 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|