C28H37N3O4 — CID 23148370
tert-butyl N-[1-[[3-[1-(3-methylbutyl)indol-3-yl]phenyl]methoxyamino]-1-oxopropan-2-yl]carbamate (PubChem CID 23148370) has the molecular formula C28H37N3O4 and a molecular weight of 479.62 g/mol. Its IUPAC name is tert-butyl N-[1-[[3-[1-(3-methylbutyl)indol-3-yl]phenyl]methoxyamino]-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[3-[1-(3-methylbutyl)indol-3-yl]phenyl]methoxyamino]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 23148370 |
| Molecular Formula | C28H37N3O4 |
| Molecular Weight | 479.62 g/mol |
| Exact Mass | 479.28 |
| IUPAC Name | tert-butyl N-[1-[[3-[1-(3-methylbutyl)indol-3-yl]phenyl]methoxyamino]-1-oxopropan-2-yl]carbamate |
| SMILES | CC(C)CCn1cc(-c2cccc(CONC(=O)C(C)NC(=O)OC(C)(C)C)c2)c2ccccc21 |
| InChI | InChI=1S/C28H37N3O4/c1-19(2)14-15-31-17-24(23-12-7-8-13-25(23)31)22-11-9-10-21(16-22)18-34-30-26(32)20(3)29-27(33)35-28(4,5)6/h7-13,16-17,19-20H,14-15,18H2,1-6H3,(H,29,33)(H,30,32) |
| InChIKey | QMHDUUIKVGIHCS-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.62 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|