C13H13ClF3NO3 — CID 23149889
3-[4-chloro-3-(trifluoromethyl)phenyl]-3-hydroxypiperidine-1-carboxylic acid (PubChem CID 23149889) has the molecular formula C13H13ClF3NO3 and a molecular weight of 323.70 g/mol. Its IUPAC name is 3-[4-chloro-3-(trifluoromethyl)phenyl]-3-hydroxypiperidine-1-carboxylic acid.
| Compound Name | 3-[4-chloro-3-(trifluoromethyl)phenyl]-3-hydroxypiperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 23149889 |
| Molecular Formula | C13H13ClF3NO3 |
| Molecular Weight | 323.70 g/mol |
| Exact Mass | 323.05 |
| IUPAC Name | 3-[4-chloro-3-(trifluoromethyl)phenyl]-3-hydroxypiperidine-1-carboxylic acid |
| SMILES | O=C(O)N1CCCC(O)(c2ccc(Cl)c(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C13H13ClF3NO3/c14-10-3-2-8(6-9(10)13(15,16)17)12(21)4-1-5-18(7-12)11(19)20/h2-3,6,21H,1,4-5,7H2,(H,19,20) |
| InChIKey | IBYILHQJWZTQID-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.70 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |