C19H17F3N2O — CID 23154981
[4-(2,5-dimethylpyrrol-1-yl)-2-(trifluoromethyl)phenyl]-pyridin-4-ylmethanol (PubChem CID 23154981) has the molecular formula C19H17F3N2O and a molecular weight of 346.35 g/mol. Its IUPAC name is [4-(2,5-dimethylpyrrol-1-yl)-2-(trifluoromethyl)phenyl]-pyridin-4-ylmethanol.
| Compound Name | [4-(2,5-dimethylpyrrol-1-yl)-2-(trifluoromethyl)phenyl]-pyridin-4-ylmethanol |
|---|---|
| PubChem CID | 23154981 |
| Molecular Formula | C19H17F3N2O |
| Molecular Weight | 346.35 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | [4-(2,5-dimethylpyrrol-1-yl)-2-(trifluoromethyl)phenyl]-pyridin-4-ylmethanol |
| SMILES | Cc1ccc(C)n1-c1ccc(C(O)c2ccncc2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H17F3N2O/c1-12-3-4-13(2)24(12)15-5-6-16(17(11-15)19(20,21)22)18(25)14-7-9-23-10-8-14/h3-11,18,25H,1-2H3 |
| InChIKey | WQYUZJYCGPAAHO-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.35 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|