C31H38FNO4 — CID 23157222
ethyl 3-[4-[[3-[4-(2-ethoxyethoxy)-2,3,6-trimethylphenyl]phenyl]methylamino]-2-fluorophenyl]propanoate (PubChem CID 23157222) has the molecular formula C31H38FNO4 and a molecular weight of 507.65 g/mol. Its IUPAC name is ethyl 3-[4-[[3-[4-(2-ethoxyethoxy)-2,3,6-trimethylphenyl]phenyl]methylamino]-2-fluorophenyl]propanoate.
| Compound Name | ethyl 3-[4-[[3-[4-(2-ethoxyethoxy)-2,3,6-trimethylphenyl]phenyl]methylamino]-2-fluorophenyl]propanoate |
|---|---|
| PubChem CID | 23157222 |
| Molecular Formula | C31H38FNO4 |
| Molecular Weight | 507.65 g/mol |
| Exact Mass | 507.28 |
| IUPAC Name | ethyl 3-[4-[[3-[4-(2-ethoxyethoxy)-2,3,6-trimethylphenyl]phenyl]methylamino]-2-fluorophenyl]propanoate |
| SMILES | CCOCCOc1cc(C)c(-c2cccc(CNc3ccc(CCC(=O)OCC)c(F)c3)c2)c(C)c1C |
| InChI | InChI=1S/C31H38FNO4/c1-6-35-15-16-37-29-17-21(3)31(23(5)22(29)4)26-10-8-9-24(18-26)20-33-27-13-11-25(28(32)19-27)12-14-30(34)36-7-2/h8-11,13,17-19,33H,6-7,12,14-16,20H2,1-5H3 |
| InChIKey | BODMFHXOUFEFLF-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.65 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|