About 5-aminodecan-5-ol diphosphate
5-aminodecan-5-ol diphosphate (PubChem CID 23158796) has the molecular formula C10H23NO9P2-6
and a molecular weight of 363.24 g/mol. Its IUPAC name is 5-aminodecan-5-ol diphosphate.
Molecular Properties
| Compound Name | 5-aminodecan-5-ol diphosphate |
| PubChem CID | 23158796 |
| Molecular Formula | C10H23NO9P2-6 |
| Molecular Weight | 363.24 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | 5-aminodecan-5-ol diphosphate |
| SMILES | CCCCCC(N)(O)CCCC.O=P([O-])([O-])[O-].O=P([O-])([O-])[O-] |
| InChI | InChI=1S/C10H23NO.2H3O4P/c1-3-5-7-9-10(11,12)8-6-4-2;2*1-5(2,3)4/h12H,3-9,11H2,1-2H3;2*(H3,1,2,3,4)/p-6 |
| InChIKey | AEKVSBJWNXLSFU-UHFFFAOYSA-H |
| XLogP | -3.24 |
| TPSA | 218.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.24 |
| LogP ≤ 5 | -3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 5-aminodecan-5-ol diphosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-aminodecan-5-ol diphosphate?
The IUPAC name of 5-aminodecan-5-ol diphosphate (CID 23158796) is 5-aminodecan-5-ol diphosphate.
What is the SMILES notation for 5-aminodecan-5-ol diphosphate?
The canonical SMILES for 5-aminodecan-5-ol diphosphate is CCCCCC(N)(O)CCCC.O=P([O-])([O-])[O-].O=P([O-])([O-])[O-].
What is the InChIKey of 5-aminodecan-5-ol diphosphate?
The InChIKey is AEKVSBJWNXLSFU-UHFFFAOYSA-H. The full InChI is InChI=1S/C10H23NO.2H3O4P/c1-3-5-7-9-10(11,12)8-6-4-2;2*1-5(2,3)4/h12H,3-9,11H2,1-2H3;2*(H3,1,2,3,4)/p-6.
What are the key properties of 5-aminodecan-5-ol diphosphate?
5-aminodecan-5-ol diphosphate has a molecular weight of 363.24 g/mol, XLogP of -3.24, 7 rotatable bonds, 2 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for 5-aminodecan-5-ol diphosphate is sourced from PubChem (CID 23158796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).