C24H19F3N2O — CID 2316714
1-(2,6-diphenyl-1,4-diazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-trien-5-yl)-2,2,2-trifluoroethanone (PubChem CID 2316714) has the molecular formula C24H19F3N2O and a molecular weight of 408.42 g/mol. Its IUPAC name is 1-(2,6-diphenyl-1,4-diazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-trien-5-yl)-2,2,2-trifluoroethanone.
| Compound Name | 1-(2,6-diphenyl-1,4-diazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-trien-5-yl)-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 2316714 |
| Molecular Formula | C24H19F3N2O |
| Molecular Weight | 408.42 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | 1-(2,6-diphenyl-1,4-diazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-trien-5-yl)-2,2,2-trifluoroethanone |
| SMILES | O=C(c1c(-c2ccccc2)c2c3n(c(-c4ccccc4)cn13)CCCC2)C(F)(F)F |
| InChI | InChI=1S/C24H19F3N2O/c25-24(26,27)22(30)21-20(17-11-5-2-6-12-17)18-13-7-8-14-28-19(15-29(21)23(18)28)16-9-3-1-4-10-16/h1-6,9-12,15H,7-8,13-14H2 |
| InChIKey | OOYRLFAIGUUZAA-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 26.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.42 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |