C30H27N3O2 — CID 3780281
2-(4-methoxyphenyl)-N,6-diphenyl-1,4-diazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carboxamide (PubChem CID 3780281) has the molecular formula C30H27N3O2 and a molecular weight of 461.57 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-N,6-diphenyl-1,4-diazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carboxamide.
| Compound Name | 2-(4-methoxyphenyl)-N,6-diphenyl-1,4-diazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carboxamide |
|---|---|
| PubChem CID | 3780281 |
| Molecular Formula | C30H27N3O2 |
| Molecular Weight | 461.57 g/mol |
| Exact Mass | 461.21 |
| IUPAC Name | 2-(4-methoxyphenyl)-N,6-diphenyl-1,4-diazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carboxamide |
| SMILES | COc1ccc(-c2cn3c(C(=O)Nc4ccccc4)c(-c4ccccc4)c4c3n2CCCC4)cc1 |
| InChI | InChI=1S/C30H27N3O2/c1-35-24-17-15-21(16-18-24)26-20-33-28(29(34)31-23-12-6-3-7-13-23)27(22-10-4-2-5-11-22)25-14-8-9-19-32(26)30(25)33/h2-7,10-13,15-18,20H,8-9,14,19H2,1H3,(H,31,34) |
| InChIKey | QSZWXWACCSPXLS-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 47.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.57 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |