C32H29Cl2N3O2 — CID 44666413
2-(3,4-dichlorophenyl)-6-(3,4-dimethylphenyl)-N-(4-methoxyphenyl)-1,4-diazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carboxamide (PubChem CID 44666413) has the molecular formula C32H29Cl2N3O2 and a molecular weight of 558.51 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-6-(3,4-dimethylphenyl)-N-(4-methoxyphenyl)-1,4-diazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carboxamide.
| Compound Name | 2-(3,4-dichlorophenyl)-6-(3,4-dimethylphenyl)-N-(4-methoxyphenyl)-1,4-diazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carboxamide |
|---|---|
| PubChem CID | 44666413 |
| Molecular Formula | C32H29Cl2N3O2 |
| Molecular Weight | 558.51 g/mol |
| Exact Mass | 557.16 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-6-(3,4-dimethylphenyl)-N-(4-methoxyphenyl)-1,4-diazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carboxamide |
| SMILES | COc1ccc(NC(=O)c2c(-c3ccc(C)c(C)c3)c3c4n(c(-c5ccc(Cl)c(Cl)c5)cn24)CCCC3)cc1 |
| InChI | InChI=1S/C32H29Cl2N3O2/c1-19-7-8-22(16-20(19)2)29-25-6-4-5-15-36-28(21-9-14-26(33)27(34)17-21)18-37(32(25)36)30(29)31(38)35-23-10-12-24(39-3)13-11-23/h7-14,16-18H,4-6,15H2,1-3H3,(H,35,38) |
| InChIKey | PZXJWNLIOHTYBL-UHFFFAOYSA-N |
| XLogP | 8.60 |
| TPSA | 47.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.51 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |