C30H24Cl3N3O — CID 3718504
6-(4-chlorophenyl)-N-(3,4-dichlorophenyl)-2-(4-methylphenyl)-1,4-diazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carboxamide (PubChem CID 3718504) has the molecular formula C30H24Cl3N3O and a molecular weight of 548.90 g/mol. Its IUPAC name is 6-(4-chlorophenyl)-N-(3,4-dichlorophenyl)-2-(4-methylphenyl)-1,4-diazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carboxamide.
| Compound Name | 6-(4-chlorophenyl)-N-(3,4-dichlorophenyl)-2-(4-methylphenyl)-1,4-diazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carboxamide |
|---|---|
| PubChem CID | 3718504 |
| Molecular Formula | C30H24Cl3N3O |
| Molecular Weight | 548.90 g/mol |
| Exact Mass | 547.10 |
| IUPAC Name | 6-(4-chlorophenyl)-N-(3,4-dichlorophenyl)-2-(4-methylphenyl)-1,4-diazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carboxamide |
| SMILES | Cc1ccc(-c2cn3c(C(=O)Nc4ccc(Cl)c(Cl)c4)c(-c4ccc(Cl)cc4)c4c3n2CCCC4)cc1 |
| InChI | InChI=1S/C30H24Cl3N3O/c1-18-5-7-19(8-6-18)26-17-36-28(29(37)34-22-13-14-24(32)25(33)16-22)27(20-9-11-21(31)12-10-20)23-4-2-3-15-35(26)30(23)36/h5-14,16-17H,2-4,15H2,1H3,(H,34,37) |
| InChIKey | XNURPTZXNSPATE-UHFFFAOYSA-N |
| XLogP | 8.93 |
| TPSA | 38.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.90 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |