C31H27Cl2N3O — CID 45132306
N-(3,4-dichlorophenyl)-6-(3,4-dimethylphenyl)-2-phenyl-1,4-diazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carboxamide (PubChem CID 45132306) has the molecular formula C31H27Cl2N3O and a molecular weight of 528.48 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-6-(3,4-dimethylphenyl)-2-phenyl-1,4-diazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carboxamide.
| Compound Name | N-(3,4-dichlorophenyl)-6-(3,4-dimethylphenyl)-2-phenyl-1,4-diazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carboxamide |
|---|---|
| PubChem CID | 45132306 |
| Molecular Formula | C31H27Cl2N3O |
| Molecular Weight | 528.48 g/mol |
| Exact Mass | 527.15 |
| IUPAC Name | N-(3,4-dichlorophenyl)-6-(3,4-dimethylphenyl)-2-phenyl-1,4-diazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carboxamide |
| SMILES | Cc1ccc(-c2c3c4n(c(-c5ccccc5)cn4c2C(=O)Nc2ccc(Cl)c(Cl)c2)CCCC3)cc1C |
| InChI | InChI=1S/C31H27Cl2N3O/c1-19-11-12-22(16-20(19)2)28-24-10-6-7-15-35-27(21-8-4-3-5-9-21)18-36(31(24)35)29(28)30(37)34-23-13-14-25(32)26(33)17-23/h3-5,8-9,11-14,16-18H,6-7,10,15H2,1-2H3,(H,34,37) |
| InChIKey | RYJHZTPWBOCTKG-UHFFFAOYSA-N |
| XLogP | 8.59 |
| TPSA | 38.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.48 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |