C32H31N3O — CID 34638207
6-(3,4-dimethylphenyl)-N-(3-methylphenyl)-2-phenyl-1,4-diazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carboxamide (PubChem CID 34638207) has the molecular formula C32H31N3O and a molecular weight of 473.62 g/mol. Its IUPAC name is 6-(3,4-dimethylphenyl)-N-(3-methylphenyl)-2-phenyl-1,4-diazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carboxamide.
| Compound Name | 6-(3,4-dimethylphenyl)-N-(3-methylphenyl)-2-phenyl-1,4-diazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carboxamide |
|---|---|
| PubChem CID | 34638207 |
| Molecular Formula | C32H31N3O |
| Molecular Weight | 473.62 g/mol |
| Exact Mass | 473.25 |
| IUPAC Name | 6-(3,4-dimethylphenyl)-N-(3-methylphenyl)-2-phenyl-1,4-diazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carboxamide |
| SMILES | Cc1cccc(NC(=O)c2c(-c3ccc(C)c(C)c3)c3c4n(c(-c5ccccc5)cn24)CCCC3)c1 |
| InChI | InChI=1S/C32H31N3O/c1-21-10-9-13-26(18-21)33-31(36)30-29(25-16-15-22(2)23(3)19-25)27-14-7-8-17-34-28(20-35(30)32(27)34)24-11-5-4-6-12-24/h4-6,9-13,15-16,18-20H,7-8,14,17H2,1-3H3,(H,33,36) |
| InChIKey | ZKGUNLXTWIRDLM-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 38.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.62 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |