C32H31N3O2 — CID 34638163
6-(3,4-dimethylphenyl)-2-(4-methoxyphenyl)-N-phenyl-1,4-diazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carboxamide (PubChem CID 34638163) has the molecular formula C32H31N3O2 and a molecular weight of 489.62 g/mol. Its IUPAC name is 6-(3,4-dimethylphenyl)-2-(4-methoxyphenyl)-N-phenyl-1,4-diazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carboxamide.
| Compound Name | 6-(3,4-dimethylphenyl)-2-(4-methoxyphenyl)-N-phenyl-1,4-diazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carboxamide |
|---|---|
| PubChem CID | 34638163 |
| Molecular Formula | C32H31N3O2 |
| Molecular Weight | 489.62 g/mol |
| Exact Mass | 489.24 |
| IUPAC Name | 6-(3,4-dimethylphenyl)-2-(4-methoxyphenyl)-N-phenyl-1,4-diazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carboxamide |
| SMILES | COc1ccc(-c2cn3c(C(=O)Nc4ccccc4)c(-c4ccc(C)c(C)c4)c4c3n2CCCC4)cc1 |
| InChI | InChI=1S/C32H31N3O2/c1-21-12-13-24(19-22(21)2)29-27-11-7-8-18-34-28(23-14-16-26(37-3)17-15-23)20-35(32(27)34)30(29)31(36)33-25-9-5-4-6-10-25/h4-6,9-10,12-17,19-20H,7-8,11,18H2,1-3H3,(H,33,36) |
| InChIKey | VRZSGZQIJXYUTN-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 47.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.62 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |