C31H27Cl2N3O3 — CID 2063151
2-(3,4-dichlorophenyl)-N,6-bis(4-methoxyphenyl)-1,4-diazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carboxamide (PubChem CID 2063151) has the molecular formula C31H27Cl2N3O3 and a molecular weight of 560.48 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-N,6-bis(4-methoxyphenyl)-1,4-diazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carboxamide.
| Compound Name | 2-(3,4-dichlorophenyl)-N,6-bis(4-methoxyphenyl)-1,4-diazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carboxamide |
|---|---|
| PubChem CID | 2063151 |
| Molecular Formula | C31H27Cl2N3O3 |
| Molecular Weight | 560.48 g/mol |
| Exact Mass | 559.14 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-N,6-bis(4-methoxyphenyl)-1,4-diazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carboxamide |
| SMILES | COc1ccc(NC(=O)c2c(-c3ccc(OC)cc3)c3c4n(c(-c5ccc(Cl)c(Cl)c5)cn24)CCCC3)cc1 |
| InChI | InChI=1S/C31H27Cl2N3O3/c1-38-22-11-6-19(7-12-22)28-24-5-3-4-16-35-27(20-8-15-25(32)26(33)17-20)18-36(31(24)35)29(28)30(37)34-21-9-13-23(39-2)14-10-21/h6-15,17-18H,3-5,16H2,1-2H3,(H,34,37) |
| InChIKey | HGWARFMIOQWGDO-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 56.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.48 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |