C30H25Cl2N3O — CID 5027936
N-(3,4-dichlorophenyl)-6-(4-methylphenyl)-2-phenyl-1,4-diazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carboxamide (PubChem CID 5027936) has the molecular formula C30H25Cl2N3O and a molecular weight of 514.46 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-6-(4-methylphenyl)-2-phenyl-1,4-diazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carboxamide.
| Compound Name | N-(3,4-dichlorophenyl)-6-(4-methylphenyl)-2-phenyl-1,4-diazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carboxamide |
|---|---|
| PubChem CID | 5027936 |
| Molecular Formula | C30H25Cl2N3O |
| Molecular Weight | 514.46 g/mol |
| Exact Mass | 513.14 |
| IUPAC Name | N-(3,4-dichlorophenyl)-6-(4-methylphenyl)-2-phenyl-1,4-diazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carboxamide |
| SMILES | Cc1ccc(-c2c3c4n(c(-c5ccccc5)cn4c2C(=O)Nc2ccc(Cl)c(Cl)c2)CCCC3)cc1 |
| InChI | InChI=1S/C30H25Cl2N3O/c1-19-10-12-21(13-11-19)27-23-9-5-6-16-34-26(20-7-3-2-4-8-20)18-35(30(23)34)28(27)29(36)33-22-14-15-24(31)25(32)17-22/h2-4,7-8,10-15,17-18H,5-6,9,16H2,1H3,(H,33,36) |
| InChIKey | XLSOTWMZIXBQKA-UHFFFAOYSA-N |
| XLogP | 8.28 |
| TPSA | 38.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.46 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |