C31H28ClN3O — CID 34319716
N-(3-chlorophenyl)-2,6-bis(4-methylphenyl)-1,4-diazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carboxamide (PubChem CID 34319716) has the molecular formula C31H28ClN3O and a molecular weight of 494.04 g/mol. Its IUPAC name is N-(3-chlorophenyl)-2,6-bis(4-methylphenyl)-1,4-diazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carboxamide.
| Compound Name | N-(3-chlorophenyl)-2,6-bis(4-methylphenyl)-1,4-diazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carboxamide |
|---|---|
| PubChem CID | 34319716 |
| Molecular Formula | C31H28ClN3O |
| Molecular Weight | 494.04 g/mol |
| Exact Mass | 493.19 |
| IUPAC Name | N-(3-chlorophenyl)-2,6-bis(4-methylphenyl)-1,4-diazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-triene-5-carboxamide |
| SMILES | Cc1ccc(-c2c3c4n(c(-c5ccc(C)cc5)cn4c2C(=O)Nc2cccc(Cl)c2)CCCC3)cc1 |
| InChI | InChI=1S/C31H28ClN3O/c1-20-9-13-22(14-10-20)27-19-35-29(30(36)33-25-7-5-6-24(32)18-25)28(23-15-11-21(2)12-16-23)26-8-3-4-17-34(27)31(26)35/h5-7,9-16,18-19H,3-4,8,17H2,1-2H3,(H,33,36) |
| InChIKey | AZBQETWOCAEPNZ-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 38.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.04 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |